1
0
Fork 0
flightgear/src/Instrumentation/rnav_waypt_controller.cxx
2010-10-20 11:48:06 +01:00

699 lines
17 KiB
C++

// rnav_waypt_controller.cxx - Waypoint-specific behaviours for RNAV systems
// Written by James Turner, started 2009.
//
// Copyright (C) 2009 Curtis L. Olson
//
// This program is free software; you can redistribute it and/or
// modify it under the terms of the GNU General Public License as
// published by the Free Software Foundation; either version 2 of the
// License, or (at your option) any later version.
//
// This program is distributed in the hope that it will be useful, but
// WITHOUT ANY WARRANTY; without even the implied warranty of
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
// General Public License for more details.
//
// You should have received a copy of the GNU General Public License
// along with this program; if not, write to the Free Software
// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
#include "rnav_waypt_controller.hxx"
#include <cassert>
#include <simgear/sg_inlines.h>
#include <simgear/structure/exception.hxx>
#include <Airports/runways.hxx>
namespace flightgear
{
const double KNOTS_TO_METRES_PER_SECOND = SG_NM_TO_METER / 3600.0;
double pmod(double x, double y)
{
if (x < 0.0) {
return -fmod(x, y);
} else {
return fmod(x,y);
}
}
// implementation of
// http://williams.best.vwh.net/avform.htm#Intersection
bool geocRadialIntersection(const SGGeoc& a, double r1, const SGGeoc& b, double r2, SGGeoc& result)
{
double crs13 = r1 * SG_DEGREES_TO_RADIANS;
double crs23 = r2 * SG_DEGREES_TO_RADIANS;
double dst12 = SGGeodesy::distanceRad(a, b);
//IF sin(lon2-lon1)<0
// crs12=acos((sin(lat2)-sin(lat1)*cos(dst12))/(sin(dst12)*cos(lat1)))
// crs21=2.*pi-acos((sin(lat1)-sin(lat2)*cos(dst12))/(sin(dst12)*cos(lat2)))
// ELSE
// crs12=2.*pi-acos((sin(lat2)-sin(lat1)*cos(dst12))/(sin(dst12)*cos(lat1)))
// crs21=acos((sin(lat1)-sin(lat2)*cos(dst12))/(sin(dst12)*cos(lat2)))
// ENDIF
// double diffLon = b.getLongitudeRad() - a.getLongitudeRad();
double sinLat1 = sin(a.getLatitudeRad());
double cosLat1 = cos(a.getLatitudeRad());
// double sinLat2 = sin(b.getLatitudeRad());
//double cosLat2 = cos(b.getLatitudeRad());
double sinDst12 = sin(dst12);
double cosDst12 = cos(dst12);
double crs12 = SGGeodesy::courseRad(a, b),
crs21 = SGGeodesy::courseRad(b, a);
double degCrs12 = crs12 * SG_RADIANS_TO_DEGREES;
double degCrs21 = crs21 * SG_RADIANS_TO_DEGREES;
/*
if (sin(diffLon) < 0.0) {
crs12 = acos((sinLat2 - sinLat1 * cosDst12) / (sinDst12 * cosLat1));
crs21 = SGMiscd::twopi() - acos((sinLat1 - sinLat2*cosDst12)/(sinDst12*cosLat2));
} else {
crs12 = SGMiscd::twopi() - acos((sinLat2 - sinLat1 * cosDst12)/(sinDst12 * cosLat1));
crs21 = acos((sinLat1 - sinLat2 * cosDst12)/(sinDst12 * cosLat2));
}
*/
double ang1 = SGMiscd::normalizeAngle2(crs13-crs12);
double ang2 = SGMiscd::normalizeAngle2(crs21-crs23);
if ((sin(ang1) == 0.0) && (sin(ang2) == 0.0)) {
SG_LOG(SG_GENERAL, SG_WARN, "geocRadialIntersection: infinity of intersections");
return false;
}
if ((sin(ang1)*sin(ang2))<0.0) {
SG_LOG(SG_GENERAL, SG_WARN, "geocRadialIntersection: intersection ambiguous");
return false;
}
ang1 = fabs(ang1);
ang2 = fabs(ang2);
//ang3=acos(-cos(ang1)*cos(ang2)+sin(ang1)*sin(ang2)*cos(dst12))
//dst13=atan2(sin(dst12)*sin(ang1)*sin(ang2),cos(ang2)+cos(ang1)*cos(ang3))
//lat3=asin(sin(lat1)*cos(dst13)+cos(lat1)*sin(dst13)*cos(crs13))
//lon3=mod(lon1-dlon+pi,2*pi)-pi
double ang3 = acos(-cos(ang1) * cos(ang2) + sin(ang1) * sin(ang2) * cosDst12);
double dst13 = atan2(sinDst12 * sin(ang1) * sin(ang2), cos(ang2) + cos(ang1)*cos(ang3));
SGGeoc pt3;
SGGeodesy::advanceRadM(a, crs13, dst13 * SG_RAD_TO_NM * SG_NM_TO_METER, pt3);
double lat3 = asin(sinLat1 * cos(dst13) + cosLat1 * sin(dst13) * cos(crs13));
//dlon=atan2(sin(crs13)*sin(dst13)*cos(lat1),cos(dst13)-sin(lat1)*sin(lat3))
double dlon = atan2(sin(crs13)*sin(dst13)*cosLat1, cos(dst13)- (sinLat1 * sin(lat3)));
double lon3 = SGMiscd::normalizeAngle(-a.getLongitudeRad()-dlon);
result = SGGeoc::fromRadM(-lon3, lat3, a.getRadiusM());
//result = pt3;
return true;
}
////////////////////////////////////////////////////////////////////////////
WayptController::~WayptController()
{
}
void WayptController::init()
{
}
void WayptController::setDone()
{
if (_isDone) {
SG_LOG(SG_AUTOPILOT, SG_WARN, "already done @ WayptController::setDone");
}
_isDone = true;
}
double WayptController::timeToWaypt() const
{
double gs = _rnav->groundSpeedKts();
if (gs < 1.0) {
return -1.0; // stationary
}
gs*= KNOTS_TO_METRES_PER_SECOND;
return (distanceToWayptM() / gs);
}
//////////////
class BasicWayptCtl : public WayptController
{
public:
BasicWayptCtl(RNAV* aRNAV, const WayptRef& aWpt) :
WayptController(aRNAV, aWpt)
{
if (aWpt->flag(WPT_DYNAMIC)) {
throw sg_exception("BasicWayptCtrl doesn't work with dynamic waypoints");
}
}
virtual void init()
{
_targetTrack = SGGeodesy::courseDeg(_rnav->position(), _waypt->position());
}
virtual void update()
{
double brg, az2;
SGGeodesy::inverse(_rnav->position(), _waypt->position(), brg, az2, _distanceM);
_courseDev = brg - _targetTrack;
SG_NORMALIZE_RANGE(_courseDev, -180.0, 180.0);
if ((fabs(_courseDev) > 90.0) && (_distanceM < _rnav->overflightArmDistanceM())) {
setDone();
}
}
virtual double distanceToWayptM() const
{
return _distanceM;
}
virtual double xtrackErrorNm() const
{
double x = sin(courseDeviationDeg() * SG_DEGREES_TO_RADIANS) * _distanceM;
return x * SG_METER_TO_NM;
}
virtual bool toFlag() const
{
return (fabs(_courseDev) < 90.0);
}
virtual double courseDeviationDeg() const
{
return _courseDev;
}
virtual double trueBearingDeg() const
{
return SGGeodesy::courseDeg(_rnav->position(), _waypt->position());
}
virtual SGGeod position() const
{
return _waypt->position();
}
private:
double _distanceM;
double _courseDev;
};
/**
* Special controller for runways. For runways, we want very narrow deviation
* contraints, and to understand that any point along the paved area is
* equivalent to being 'at' the runway.
*/
class RunwayCtl : public WayptController
{
public:
RunwayCtl(RNAV* aRNAV, const WayptRef& aWpt) :
WayptController(aRNAV, aWpt)
{
}
virtual void init()
{
_runway = static_cast<RunwayWaypt*>(_waypt.get())->runway();
_targetTrack = _runway->headingDeg();
}
virtual void update()
{
double brg, az2;
// use the far end of the runway for course deviation calculations.
// this should do the correct thing both for takeoffs (including entering
// the runway at a taxiway after the threshold) and also landings.
// seperately compute the distance to the threshold for timeToWaypt calc
SGGeodesy::inverse(_rnav->position(), _runway->end(), brg, az2, _distanceM);
double _courseDev = brg - _targetTrack;
SG_NORMALIZE_RANGE(_courseDev, -180.0, 180.0);
if (fabs(_courseDev) > 90.0) {
setDone();
}
}
virtual double distanceToWayptM() const
{
return SGGeodesy::distanceM(_rnav->position(), _runway->threshold());
}
virtual double xtrackErrorNm() const
{
double x = sin(_courseDev * SG_RADIANS_TO_DEGREES) * _distanceM;
return x * SG_METER_TO_NM;
}
virtual double courseDeviationDeg() const
{
return _courseDev;
}
virtual double trueBearingDeg() const
{
// as in update(), use runway->end here, so the value remains
// sensible whether taking off or landing.
return SGGeodesy::courseDeg(_rnav->position(), _runway->end());
}
virtual SGGeod position() const
{
return _runway->threshold();
}
private:
FGRunway* _runway;
double _distanceM;
double _courseDev;
};
class ConstHdgToAltCtl : public WayptController
{
public:
ConstHdgToAltCtl(RNAV* aRNAV, const WayptRef& aWpt) :
WayptController(aRNAV, aWpt)
{
if (_waypt->type() != "hdgToAlt") {
throw sg_exception("invalid waypoint type", "ConstHdgToAltCtl ctor");
}
if (_waypt->altitudeRestriction() == RESTRICT_NONE) {
throw sg_exception("invalid waypoint alt restriction", "ConstHdgToAltCtl ctor");
}
}
virtual void init()
{
HeadingToAltitude* w = (HeadingToAltitude*) _waypt.get();
_targetTrack = w->headingDegMagnetic() + _rnav->magvarDeg();
}
virtual void update()
{
double curAlt = _rnav->position().getElevationFt();
switch (_waypt->altitudeRestriction()) {
case RESTRICT_AT: {
double d = curAlt - _waypt->altitudeFt();
if (fabs(d) < 50.0) {
SG_LOG(SG_GENERAL, SG_INFO, "ConstHdgToAltCtl, reached target altitude " << _waypt->altitudeFt());
setDone();
}
} break;
case RESTRICT_ABOVE:
if (curAlt >= _waypt->altitudeFt()) {
SG_LOG(SG_GENERAL, SG_INFO, "ConstHdgToAltCtl, above target altitude " << _waypt->altitudeFt());
setDone();
}
break;
case RESTRICT_BELOW:
if (curAlt <= _waypt->altitudeFt()) {
SG_LOG(SG_GENERAL, SG_INFO, "ConstHdgToAltCtl, below target altitude " << _waypt->altitudeFt());
setDone();
}
break;
case RESTRICT_NONE:
assert(false);
break;
}
}
virtual double timeToWaypt() const
{
double d = fabs(_rnav->position().getElevationFt() - _waypt->altitudeFt());
return (d / _rnav->vspeedFPM()) * 60.0; // low pass filter here, probably
}
virtual double distanceToWayptM() const
{
double gsMsec = _rnav->groundSpeedKts() * KNOTS_TO_METRES_PER_SECOND;
return timeToWaypt() * gsMsec;
}
virtual SGGeod position() const
{
SGGeod p;
double az2;
SGGeodesy::direct(_rnav->position(), _targetTrack, distanceToWayptM(), p, az2);
return p;
}
};
class InterceptCtl : public WayptController
{
public:
InterceptCtl(RNAV* aRNAV, const WayptRef& aWpt) :
WayptController(aRNAV, aWpt)
{
if (_waypt->type() != "radialIntercept") {
throw sg_exception("invalid waypoint type", "InterceptCtl ctor");
}
}
virtual void init()
{
RadialIntercept* w = (RadialIntercept*) _waypt.get();
_trueRadial = w->radialDegMagnetic() + _rnav->magvarDeg();
_targetTrack = w->courseDegMagnetic() + _rnav->magvarDeg();
}
virtual void update()
{
// note we want the outbound radial from the waypt, hence the ordering
// of arguments to courseDeg
double r = SGGeodesy::courseDeg(_waypt->position(), _rnav->position());
SG_LOG(SG_AUTOPILOT, SG_INFO, "current radial=" << r);
if (fabs(r - _trueRadial) < 0.5) {
SG_LOG(SG_GENERAL, SG_INFO, "InterceptCtl, intercepted radial " << _trueRadial);
setDone();
}
}
virtual double distanceToWayptM() const
{
return SGGeodesy::distanceM(_rnav->position(), position());
}
virtual SGGeod position() const
{
SGGeoc c;
geocRadialIntersection(SGGeoc::fromGeod(_rnav->position()), _rnav->trackDeg(),
SGGeoc::fromGeod(_waypt->position()), _trueRadial, c);
return SGGeod::fromGeoc(c);
}
private:
double _trueRadial;
};
class DMEInterceptCtl : public WayptController
{
public:
DMEInterceptCtl(RNAV* aRNAV, const WayptRef& aWpt) :
WayptController(aRNAV, aWpt)
{
if (_waypt->type() != "dmeIntercept") {
throw sg_exception("invalid waypoint type", "DMEInterceptCtl ctor");
}
}
virtual void init()
{
_dme = (DMEIntercept*) _waypt.get();
_targetTrack = _dme->courseDegMagnetic() + _rnav->magvarDeg();
}
virtual void update()
{
_distanceNm = SGGeodesy::distanceNm(_rnav->position(), _dme->position());
double d = fabs(_distanceNm - _dme->dmeDistanceNm());
if (d < 0.1) {
SG_LOG(SG_GENERAL, SG_INFO, "DMEInterceptCtl, intercepted DME " << _dme->dmeDistanceNm());
setDone();
}
}
virtual double distanceToWayptM() const
{
return fabs(_distanceNm - _dme->dmeDistanceNm()) * SG_NM_TO_METER;
}
virtual SGGeod position() const
{
SGGeod p;
double az2;
SGGeodesy::direct(_rnav->position(), _targetTrack, distanceToWayptM(), p, az2);
return p;
}
private:
DMEIntercept* _dme;
double _distanceNm;
};
class HoldCtl : public WayptController
{
public:
HoldCtl(RNAV* aRNAV, const WayptRef& aWpt) :
WayptController(aRNAV, aWpt)
{
}
virtual void init()
{
}
virtual void update()
{
// fly inbound / outbound sides, or execute the turn
#if 0
if (inTurn) {
targetTrack += dt * turnRateSec * turnDirection;
if (inbound) {
if .. targetTrack has passed inbound radial, doen with this turn
} else {
if target track has passed reciprocal radial done with turn
}
} else {
check time / distance elapsed
if (sideDone) {
inTurn = true;
inbound = !inbound;
nextHeading = inbound;
if (!inbound) {
nextHeading += 180.0;
SG_NORMALIZE_RANGE(nextHeading, 0.0, 360.0);
}
}
}
#endif
setDone();
}
virtual double distanceToWayptM() const
{
return -1.0;
}
virtual SGGeod position() const
{
return _waypt->position();
}
};
class VectorsCtl : public WayptController
{
public:
VectorsCtl(RNAV* aRNAV, const WayptRef& aWpt) :
WayptController(aRNAV, aWpt)
{
}
virtual void init()
{
}
virtual void update()
{
setDone();
}
virtual double distanceToWayptM() const
{
return -1.0;
}
virtual SGGeod position() const
{
return _waypt->position();
}
private:
};
///////////////////////////////////////////////////////////////////////////////
DirectToController::DirectToController(RNAV* aRNAV, const WayptRef& aWpt, const SGGeod& aOrigin) :
WayptController(aRNAV, aWpt),
_origin(aOrigin)
{
}
void DirectToController::init()
{
if (_waypt->flag(WPT_DYNAMIC)) {
throw sg_exception("can't direct-to a dynamic waypoint");
}
_targetTrack = SGGeodesy::courseDeg(_origin, _waypt->position());
}
void DirectToController::update()
{
double brg, az2;
SGGeodesy::inverse(_rnav->position(), _waypt->position(), brg, az2, _distanceM);
_courseDev = brg - _targetTrack;
SG_NORMALIZE_RANGE(_courseDev, -180.0, 180.0);
if ((fabs(_courseDev) > 90.0) && (_distanceM < _rnav->overflightArmDistanceM())) {
setDone();
}
}
double DirectToController::distanceToWayptM() const
{
return _distanceM;
}
double DirectToController::xtrackErrorNm() const
{
double x = sin(courseDeviationDeg() * SG_DEGREES_TO_RADIANS) * _distanceM;
return x * SG_METER_TO_NM;
}
double DirectToController::courseDeviationDeg() const
{
return _courseDev;
}
double DirectToController::trueBearingDeg() const
{
return SGGeodesy::courseDeg(_rnav->position(), _waypt->position());
}
SGGeod DirectToController::position() const
{
return _waypt->position();
}
///////////////////////////////////////////////////////////////////////////////
OBSController::OBSController(RNAV* aRNAV, const WayptRef& aWpt) :
WayptController(aRNAV, aWpt)
{
}
void OBSController::init()
{
if (_waypt->flag(WPT_DYNAMIC)) {
throw sg_exception("can't use a dynamic waypoint for OBS mode");
}
_targetTrack = _rnav->selectedMagCourse() + _rnav->magvarDeg();
}
void OBSController::update()
{
_targetTrack = _rnav->selectedMagCourse() + _rnav->magvarDeg();
double brg, az2;
SGGeodesy::inverse(_rnav->position(), _waypt->position(), brg, az2, _distanceM);
_courseDev = brg - _targetTrack;
SG_NORMALIZE_RANGE(_courseDev, -180.0, 180.0);
}
bool OBSController::toFlag() const
{
return (fabs(_courseDev) < 90.0);
}
double OBSController::distanceToWayptM() const
{
return _distanceM;
}
double OBSController::xtrackErrorNm() const
{
double x = sin(_courseDev * SG_DEGREES_TO_RADIANS) * _distanceM;
return x * SG_METER_TO_NM;
}
double OBSController::courseDeviationDeg() const
{
// if (fabs(_courseDev) > 90.0) {
// double d = -_courseDev;
// SG_NORMALIZE_RANGE(d, -90.0, 90.0);
// return d;
//}
return _courseDev;
}
double OBSController::trueBearingDeg() const
{
return SGGeodesy::courseDeg(_rnav->position(), _waypt->position());
}
SGGeod OBSController::position() const
{
return _waypt->position();
}
///////////////////////////////////////////////////////////////////////////////
WayptController* WayptController::createForWaypt(RNAV* aRNAV, const WayptRef& aWpt)
{
if (!aWpt) {
throw sg_exception("Passed null waypt", "WayptController::createForWaypt");
}
const std::string& wty(aWpt->type());
if (wty == "runway") {
return new RunwayCtl(aRNAV, aWpt);
}
if (wty == "radialIntercept") {
return new InterceptCtl(aRNAV, aWpt);
}
if (wty == "dmeIntercept") {
return new DMEInterceptCtl(aRNAV, aWpt);
}
if (wty == "hdgToAlt") {
return new ConstHdgToAltCtl(aRNAV, aWpt);
}
if (wty == "vectors") {
return new VectorsCtl(aRNAV, aWpt);
}
if (wty == "hold") {
return new HoldCtl(aRNAV, aWpt);
}
return new BasicWayptCtl(aRNAV, aWpt);
}
} // of namespace flightgear