2009-10-11 12:37:13 +01:00
|
|
|
// rnav_waypt_controller.cxx - Waypoint-specific behaviours for RNAV systems
|
|
|
|
// Written by James Turner, started 2009.
|
|
|
|
//
|
|
|
|
// Copyright (C) 2009 Curtis L. Olson
|
|
|
|
//
|
|
|
|
// This program is free software; you can redistribute it and/or
|
|
|
|
// modify it under the terms of the GNU General Public License as
|
|
|
|
// published by the Free Software Foundation; either version 2 of the
|
|
|
|
// License, or (at your option) any later version.
|
|
|
|
//
|
|
|
|
// This program is distributed in the hope that it will be useful, but
|
|
|
|
// WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
|
|
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
|
|
|
|
// General Public License for more details.
|
|
|
|
//
|
|
|
|
// You should have received a copy of the GNU General Public License
|
|
|
|
// along with this program; if not, write to the Free Software
|
|
|
|
// Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
|
|
|
|
|
|
|
|
#include "rnav_waypt_controller.hxx"
|
|
|
|
|
2010-10-20 11:48:06 +01:00
|
|
|
#include <cassert>
|
|
|
|
|
2009-10-11 12:37:13 +01:00
|
|
|
#include <simgear/sg_inlines.h>
|
|
|
|
#include <simgear/structure/exception.hxx>
|
|
|
|
|
|
|
|
#include <Airports/runways.hxx>
|
2015-01-02 23:58:29 +00:00
|
|
|
#include "Main/util.hxx" // for fgLowPass
|
2009-10-11 12:37:13 +01:00
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
extern double pointsKnownDistanceFromGC(const SGGeoc& a, const SGGeoc&b, const SGGeoc& d, double dist);
|
2009-10-11 12:37:13 +01:00
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
namespace flightgear
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
|
2015-12-10 15:06:33 -06:00
|
|
|
// declared in routePath.cxx
|
|
|
|
bool geocRadialIntersection(const SGGeoc& a, double r1, const SGGeoc& b, double r2, SGGeoc& result);
|
2009-10-11 12:37:13 +01:00
|
|
|
|
2013-07-27 14:06:03 +02:00
|
|
|
/**
|
|
|
|
* Helper function Cross track error:
|
|
|
|
* http://williams.best.vwh.net/avform.htm#XTE
|
|
|
|
*
|
|
|
|
* param distanceOriginToPosition in Nautical Miles
|
|
|
|
* param courseDev difference between courseOriginToAircraft(AD) and courseOriginToTarget(AB)
|
|
|
|
* return XTE in Nautical Miles
|
|
|
|
*
|
|
|
|
* A(origin)
|
|
|
|
* B(target)
|
|
|
|
* D(aircraft) perhaps off course
|
|
|
|
*
|
|
|
|
* A-->--B
|
|
|
|
* \ /
|
|
|
|
* \ /
|
|
|
|
* D
|
|
|
|
*/
|
|
|
|
|
|
|
|
double greatCircleCrossTrackError(double distanceOriginToPosition,double courseDev){
|
|
|
|
double crossTrackError = asin(
|
|
|
|
sin(distanceOriginToPosition * SG_NM_TO_RAD) *
|
|
|
|
sin(courseDev * SG_DEGREES_TO_RADIANS)
|
|
|
|
);
|
|
|
|
return crossTrackError * SG_RAD_TO_NM;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
2009-10-11 12:37:13 +01:00
|
|
|
////////////////////////////////////////////////////////////////////////////
|
|
|
|
|
|
|
|
WayptController::~WayptController()
|
|
|
|
{
|
|
|
|
}
|
|
|
|
|
|
|
|
void WayptController::init()
|
|
|
|
{
|
|
|
|
}
|
|
|
|
|
|
|
|
void WayptController::setDone()
|
|
|
|
{
|
|
|
|
if (_isDone) {
|
|
|
|
SG_LOG(SG_AUTOPILOT, SG_WARN, "already done @ WayptController::setDone");
|
|
|
|
}
|
|
|
|
|
|
|
|
_isDone = true;
|
|
|
|
}
|
|
|
|
|
|
|
|
double WayptController::timeToWaypt() const
|
|
|
|
{
|
|
|
|
double gs = _rnav->groundSpeedKts();
|
|
|
|
if (gs < 1.0) {
|
|
|
|
return -1.0; // stationary
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
gs*= SG_KT_TO_MPS;
|
2009-10-11 12:37:13 +01:00
|
|
|
return (distanceToWayptM() / gs);
|
|
|
|
}
|
|
|
|
|
|
|
|
//////////////
|
|
|
|
|
|
|
|
class BasicWayptCtl : public WayptController
|
|
|
|
{
|
|
|
|
public:
|
|
|
|
BasicWayptCtl(RNAV* aRNAV, const WayptRef& aWpt) :
|
2010-12-05 20:35:21 +01:00
|
|
|
WayptController(aRNAV, aWpt),
|
2013-07-27 14:06:03 +02:00
|
|
|
_distanceAircraftTargetMeter(0.0),
|
2010-12-05 20:35:21 +01:00
|
|
|
_courseDev(0.0)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
if (aWpt->flag(WPT_DYNAMIC)) {
|
|
|
|
throw sg_exception("BasicWayptCtrl doesn't work with dynamic waypoints");
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual void init()
|
|
|
|
{
|
|
|
|
_targetTrack = SGGeodesy::courseDeg(_rnav->position(), _waypt->position());
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual void update(double)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
double bearingAircraftToTarget;
|
|
|
|
|
|
|
|
bearingAircraftToTarget = SGGeodesy::courseDeg(_rnav->position(), _waypt->position());
|
|
|
|
_distanceAircraftTargetMeter = SGGeodesy::distanceM(_rnav->position(), _waypt->position());
|
|
|
|
|
|
|
|
_courseDev = bearingAircraftToTarget - _targetTrack;
|
2009-10-11 12:37:13 +01:00
|
|
|
SG_NORMALIZE_RANGE(_courseDev, -180.0, 180.0);
|
|
|
|
|
2013-07-27 14:06:03 +02:00
|
|
|
if ((fabs(_courseDev) > _rnav->overflightArmAngleDeg()) && (_distanceAircraftTargetMeter < _rnav->overflightArmDistanceM())) {
|
2009-10-11 12:37:13 +01:00
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double distanceToWayptM() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
return _distanceAircraftTargetMeter;
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
virtual double xtrackErrorNm() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
double x = sin(courseDeviationDeg() * SG_DEGREES_TO_RADIANS) * _distanceAircraftTargetMeter;
|
2009-10-11 12:37:13 +01:00
|
|
|
return x * SG_METER_TO_NM;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual bool toFlag() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
return (fabs(_courseDev) < _rnav->overflightArmAngleDeg());
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
virtual double courseDeviationDeg() const
|
|
|
|
{
|
|
|
|
return _courseDev;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double trueBearingDeg() const
|
|
|
|
{
|
|
|
|
return SGGeodesy::courseDeg(_rnav->position(), _waypt->position());
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual SGGeod position() const
|
|
|
|
{
|
|
|
|
return _waypt->position();
|
|
|
|
}
|
|
|
|
|
|
|
|
private:
|
2013-07-27 14:06:03 +02:00
|
|
|
double _distanceAircraftTargetMeter;
|
|
|
|
double _courseDev;
|
|
|
|
};
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Controller for leg course interception.
|
|
|
|
* In leg mode, we want to intercept the leg between 2 waypoints(A->B).
|
|
|
|
* If we can't reach the the selected waypoint leg,we going direct to B.
|
|
|
|
*/
|
|
|
|
|
|
|
|
class LegWayptCtl : public WayptController
|
|
|
|
{
|
|
|
|
public:
|
|
|
|
LegWayptCtl(RNAV* aRNAV, const WayptRef& aWpt) :
|
|
|
|
WayptController(aRNAV, aWpt),
|
|
|
|
_waypointOrigin(),
|
2015-01-10 17:54:48 +00:00
|
|
|
_distanceOriginAircraftMetre(0.0),
|
|
|
|
_distanceAircraftTargetMetre(0.0),
|
2013-07-27 14:06:03 +02:00
|
|
|
_courseOriginToAircraft(0.0),
|
|
|
|
_courseAircraftToTarget(0.0),
|
|
|
|
_courseDev(0.0),
|
|
|
|
_toFlag(true)
|
|
|
|
{
|
|
|
|
if (aWpt->flag(WPT_DYNAMIC)) {
|
|
|
|
throw sg_exception("LegWayptCtl doesn't work with dynamic waypoints");
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual void init()
|
|
|
|
{
|
|
|
|
double courseOriginTarget;
|
|
|
|
bool isPreviousLegValid = false;
|
|
|
|
|
|
|
|
_waypointOrigin = _rnav->previousLegWaypointPosition(isPreviousLegValid);
|
|
|
|
|
|
|
|
courseOriginTarget = SGGeodesy::courseDeg(_waypointOrigin,_waypt->position());
|
|
|
|
|
|
|
|
_courseAircraftToTarget = SGGeodesy::courseDeg(_rnav->position(),_waypt->position());
|
2015-01-10 17:54:48 +00:00
|
|
|
_distanceAircraftTargetMetre = SGGeodesy::distanceM(_rnav->position(),_waypt->position());
|
2013-07-27 14:06:03 +02:00
|
|
|
|
|
|
|
|
|
|
|
// check reach the leg in 45Deg or going direct
|
|
|
|
bool canReachLeg = (fabs(courseOriginTarget -_courseAircraftToTarget) < 45.0);
|
|
|
|
|
|
|
|
if ( isPreviousLegValid && canReachLeg){
|
|
|
|
_targetTrack = courseOriginTarget;
|
|
|
|
}else{
|
|
|
|
_targetTrack = _courseAircraftToTarget;
|
|
|
|
_waypointOrigin = _rnav->position();
|
|
|
|
}
|
|
|
|
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual void update(double)
|
2013-07-27 14:06:03 +02:00
|
|
|
{
|
|
|
|
_courseOriginToAircraft = SGGeodesy::courseDeg(_waypointOrigin,_rnav->position());
|
2015-01-10 17:54:48 +00:00
|
|
|
_distanceOriginAircraftMetre = SGGeodesy::distanceM(_waypointOrigin,_rnav->position());
|
2013-07-27 14:06:03 +02:00
|
|
|
|
|
|
|
_courseAircraftToTarget = SGGeodesy::courseDeg(_rnav->position(),_waypt->position());
|
2015-01-10 17:54:48 +00:00
|
|
|
_distanceAircraftTargetMetre = SGGeodesy::distanceM(_rnav->position(),_waypt->position());
|
2013-07-27 14:06:03 +02:00
|
|
|
|
|
|
|
_courseDev = -(_courseOriginToAircraft - _targetTrack);
|
|
|
|
|
2015-01-10 17:54:48 +00:00
|
|
|
bool isMinimumOverFlightDistanceReached = _distanceAircraftTargetMetre < _rnav->overflightDistanceM();
|
|
|
|
bool isOverFlightConeArmed = _distanceAircraftTargetMetre < ( _rnav->overflightArmDistanceM() + _rnav->overflightDistanceM() );
|
2013-07-27 14:06:03 +02:00
|
|
|
bool leavingOverFlightCone = (fabs(_courseAircraftToTarget - _targetTrack) > _rnav->overflightArmAngleDeg());
|
|
|
|
|
|
|
|
if( isMinimumOverFlightDistanceReached ){
|
|
|
|
_toFlag = false;
|
|
|
|
setDone();
|
|
|
|
}else{
|
|
|
|
if( isOverFlightConeArmed ){
|
|
|
|
_toFlag = false;
|
|
|
|
if ( leavingOverFlightCone ) {
|
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
}else{
|
|
|
|
_toFlag = true;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double distanceToWayptM() const
|
|
|
|
{
|
2015-01-10 17:54:48 +00:00
|
|
|
return _distanceAircraftTargetMetre;
|
2013-07-27 14:06:03 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
virtual double xtrackErrorNm() const
|
|
|
|
{
|
2015-01-10 17:54:48 +00:00
|
|
|
return greatCircleCrossTrackError(_distanceOriginAircraftMetre * SG_METER_TO_NM, _courseDev);
|
2013-07-27 14:06:03 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
virtual bool toFlag() const
|
|
|
|
{
|
|
|
|
return _toFlag;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double courseDeviationDeg() const
|
|
|
|
{
|
|
|
|
return _courseDev;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double trueBearingDeg() const
|
|
|
|
{
|
|
|
|
return _courseAircraftToTarget;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual SGGeod position() const
|
|
|
|
{
|
|
|
|
return _waypt->position();
|
|
|
|
}
|
|
|
|
|
|
|
|
private:
|
|
|
|
|
|
|
|
/*
|
|
|
|
* great circle route
|
|
|
|
* A(from), B(to), D(position) perhaps off course
|
|
|
|
*/
|
|
|
|
SGGeod _waypointOrigin;
|
2015-01-10 17:54:48 +00:00
|
|
|
double _distanceOriginAircraftMetre;
|
|
|
|
double _distanceAircraftTargetMetre;
|
2013-07-27 14:06:03 +02:00
|
|
|
double _courseOriginToAircraft;
|
|
|
|
double _courseAircraftToTarget;
|
2009-10-11 12:37:13 +01:00
|
|
|
double _courseDev;
|
2013-07-27 14:06:03 +02:00
|
|
|
bool _toFlag;
|
|
|
|
|
2009-10-11 12:37:13 +01:00
|
|
|
};
|
|
|
|
|
|
|
|
/**
|
|
|
|
* Special controller for runways. For runways, we want very narrow deviation
|
2011-01-28 00:06:23 +01:00
|
|
|
* constraints, and to understand that any point along the paved area is
|
2009-10-11 12:37:13 +01:00
|
|
|
* equivalent to being 'at' the runway.
|
|
|
|
*/
|
|
|
|
class RunwayCtl : public WayptController
|
|
|
|
{
|
|
|
|
public:
|
|
|
|
RunwayCtl(RNAV* aRNAV, const WayptRef& aWpt) :
|
2010-12-05 20:35:21 +01:00
|
|
|
WayptController(aRNAV, aWpt),
|
|
|
|
_runway(NULL),
|
2013-07-27 14:06:03 +02:00
|
|
|
_distanceAircraftRunwayEnd(0.0),
|
2010-12-05 20:35:21 +01:00
|
|
|
_courseDev(0.0)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual void init()
|
|
|
|
{
|
|
|
|
_runway = static_cast<RunwayWaypt*>(_waypt.get())->runway();
|
|
|
|
_targetTrack = _runway->headingDeg();
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual void update(double)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
double bearingAircraftRunwayEnd;
|
2009-10-11 12:37:13 +01:00
|
|
|
// use the far end of the runway for course deviation calculations.
|
|
|
|
// this should do the correct thing both for takeoffs (including entering
|
|
|
|
// the runway at a taxiway after the threshold) and also landings.
|
|
|
|
// seperately compute the distance to the threshold for timeToWaypt calc
|
2013-07-27 14:06:03 +02:00
|
|
|
|
|
|
|
bearingAircraftRunwayEnd = SGGeodesy::courseDeg(_rnav->position(), _runway->end());
|
|
|
|
_distanceAircraftRunwayEnd = SGGeodesy::distanceM(_rnav->position(), _runway->end());
|
|
|
|
|
|
|
|
double _courseDev = bearingAircraftRunwayEnd - _targetTrack;
|
2009-10-11 12:37:13 +01:00
|
|
|
SG_NORMALIZE_RANGE(_courseDev, -180.0, 180.0);
|
|
|
|
|
2013-07-27 14:06:03 +02:00
|
|
|
if ((fabs(_courseDev) > _rnav->overflightArmAngleDeg()) && (_distanceAircraftRunwayEnd < _rnav->overflightArmDistanceM())) {
|
2009-10-11 12:37:13 +01:00
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double distanceToWayptM() const
|
|
|
|
{
|
|
|
|
return SGGeodesy::distanceM(_rnav->position(), _runway->threshold());
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double xtrackErrorNm() const
|
|
|
|
{
|
2015-01-10 19:35:34 +00:00
|
|
|
double x = sin(_courseDev * SG_DEGREES_TO_RADIANS) * _distanceAircraftRunwayEnd;
|
2009-10-11 12:37:13 +01:00
|
|
|
return x * SG_METER_TO_NM;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double courseDeviationDeg() const
|
|
|
|
{
|
|
|
|
return _courseDev;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double trueBearingDeg() const
|
|
|
|
{
|
|
|
|
// as in update(), use runway->end here, so the value remains
|
|
|
|
// sensible whether taking off or landing.
|
|
|
|
return SGGeodesy::courseDeg(_rnav->position(), _runway->end());
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual SGGeod position() const
|
|
|
|
{
|
|
|
|
return _runway->threshold();
|
|
|
|
}
|
|
|
|
private:
|
|
|
|
FGRunway* _runway;
|
2013-07-27 14:06:03 +02:00
|
|
|
double _distanceAircraftRunwayEnd;
|
2009-10-11 12:37:13 +01:00
|
|
|
double _courseDev;
|
|
|
|
};
|
|
|
|
|
|
|
|
class ConstHdgToAltCtl : public WayptController
|
|
|
|
{
|
|
|
|
public:
|
|
|
|
ConstHdgToAltCtl(RNAV* aRNAV, const WayptRef& aWpt) :
|
|
|
|
WayptController(aRNAV, aWpt)
|
|
|
|
|
|
|
|
{
|
|
|
|
if (_waypt->type() != "hdgToAlt") {
|
|
|
|
throw sg_exception("invalid waypoint type", "ConstHdgToAltCtl ctor");
|
|
|
|
}
|
|
|
|
|
|
|
|
if (_waypt->altitudeRestriction() == RESTRICT_NONE) {
|
|
|
|
throw sg_exception("invalid waypoint alt restriction", "ConstHdgToAltCtl ctor");
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual void init()
|
|
|
|
{
|
|
|
|
HeadingToAltitude* w = (HeadingToAltitude*) _waypt.get();
|
|
|
|
_targetTrack = w->headingDegMagnetic() + _rnav->magvarDeg();
|
2015-01-02 23:58:29 +00:00
|
|
|
_filteredFPM = _lastFPM = _rnav->vspeedFPM();
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual void update(double dt)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
double curAlt = _rnav->position().getElevationFt();
|
2015-01-02 23:58:29 +00:00
|
|
|
// adjust to get a stable FPM value; bigger values mean slower
|
|
|
|
// response but more stable.
|
|
|
|
const double RESPONSIVENESS = 1.0;
|
|
|
|
|
|
|
|
_filteredFPM = fgGetLowPass(_lastFPM, _rnav->vspeedFPM(), dt * RESPONSIVENESS);
|
|
|
|
_lastFPM = _rnav->vspeedFPM();
|
|
|
|
|
2009-10-11 12:37:13 +01:00
|
|
|
switch (_waypt->altitudeRestriction()) {
|
2012-04-24 22:55:30 +01:00
|
|
|
case RESTRICT_AT:
|
|
|
|
case RESTRICT_COMPUTED:
|
|
|
|
{
|
2009-10-11 12:37:13 +01:00
|
|
|
double d = curAlt - _waypt->altitudeFt();
|
|
|
|
if (fabs(d) < 50.0) {
|
2011-12-11 13:55:56 +01:00
|
|
|
SG_LOG(SG_INSTR, SG_INFO, "ConstHdgToAltCtl, reached target altitude " << _waypt->altitudeFt());
|
2009-10-11 12:37:13 +01:00
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
} break;
|
|
|
|
|
|
|
|
case RESTRICT_ABOVE:
|
|
|
|
if (curAlt >= _waypt->altitudeFt()) {
|
2011-12-11 13:55:56 +01:00
|
|
|
SG_LOG(SG_INSTR, SG_INFO, "ConstHdgToAltCtl, above target altitude " << _waypt->altitudeFt());
|
2009-10-11 12:37:13 +01:00
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
case RESTRICT_BELOW:
|
|
|
|
if (curAlt <= _waypt->altitudeFt()) {
|
2011-12-11 13:55:56 +01:00
|
|
|
SG_LOG(SG_INSTR, SG_INFO, "ConstHdgToAltCtl, below target altitude " << _waypt->altitudeFt());
|
2009-10-11 12:37:13 +01:00
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
2012-04-24 22:55:30 +01:00
|
|
|
default:
|
2011-02-02 22:05:54 +01:00
|
|
|
break;
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double timeToWaypt() const
|
|
|
|
{
|
|
|
|
double d = fabs(_rnav->position().getElevationFt() - _waypt->altitudeFt());
|
2015-01-02 23:58:29 +00:00
|
|
|
return (d / _filteredFPM) * 60.0;
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
virtual double distanceToWayptM() const
|
|
|
|
{
|
2015-01-02 23:58:29 +00:00
|
|
|
// we could filter ground speed here, but it's likely stable enough,
|
|
|
|
// and timeToWaypt already filters the FPM value
|
|
|
|
double gsMsec = _rnav->groundSpeedKts() * SG_KT_TO_MPS;
|
2009-10-11 12:37:13 +01:00
|
|
|
return timeToWaypt() * gsMsec;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual SGGeod position() const
|
|
|
|
{
|
|
|
|
SGGeod p;
|
|
|
|
double az2;
|
|
|
|
SGGeodesy::direct(_rnav->position(), _targetTrack, distanceToWayptM(), p, az2);
|
|
|
|
return p;
|
|
|
|
}
|
2015-01-02 23:58:29 +00:00
|
|
|
|
|
|
|
private:
|
|
|
|
double _lastFPM, _filteredFPM;
|
2009-10-11 12:37:13 +01:00
|
|
|
};
|
|
|
|
|
|
|
|
class InterceptCtl : public WayptController
|
|
|
|
{
|
|
|
|
public:
|
|
|
|
InterceptCtl(RNAV* aRNAV, const WayptRef& aWpt) :
|
2010-12-05 20:35:21 +01:00
|
|
|
WayptController(aRNAV, aWpt),
|
|
|
|
_trueRadial(0.0)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
if (_waypt->type() != "radialIntercept") {
|
|
|
|
throw sg_exception("invalid waypoint type", "InterceptCtl ctor");
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual void init()
|
|
|
|
{
|
|
|
|
RadialIntercept* w = (RadialIntercept*) _waypt.get();
|
2015-01-10 17:56:49 +00:00
|
|
|
_trueRadial = w->radialDegMagnetic() + _rnav->magvarDeg();
|
2009-10-11 12:37:13 +01:00
|
|
|
_targetTrack = w->courseDegMagnetic() + _rnav->magvarDeg();
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual void update(double)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
2015-01-10 17:56:49 +00:00
|
|
|
SGGeoc c,
|
|
|
|
geocPos = SGGeoc::fromGeod(_rnav->position()),
|
|
|
|
geocWayptPos = SGGeoc::fromGeod(_waypt->position());
|
|
|
|
|
|
|
|
bool ok = geocRadialIntersection(geocPos, _targetTrack,
|
|
|
|
geocWayptPos, _trueRadial, c);
|
|
|
|
if (!ok) {
|
|
|
|
// try with a backwards offset from the waypt pos, in case the
|
|
|
|
// procedure waypt location is too close. (eg, KSFO OCEAN SID)
|
|
|
|
|
|
|
|
SGGeoc navidAdjusted;
|
|
|
|
SGGeodesy::advanceRadM(geocWayptPos, _trueRadial, SG_NM_TO_METER * -10, navidAdjusted);
|
|
|
|
|
|
|
|
ok = geocRadialIntersection(geocPos, _targetTrack,
|
|
|
|
navidAdjusted, _trueRadial, c);
|
|
|
|
if (!ok) {
|
|
|
|
SG_LOG(SG_INSTR, SG_WARN, "InterceptCtl, bad intersection, skipping waypt");
|
|
|
|
setDone();
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
_projectedPosition = SGGeod::fromGeoc(c);
|
|
|
|
|
|
|
|
|
2009-10-11 12:37:13 +01:00
|
|
|
// note we want the outbound radial from the waypt, hence the ordering
|
|
|
|
// of arguments to courseDeg
|
|
|
|
double r = SGGeodesy::courseDeg(_waypt->position(), _rnav->position());
|
2015-01-10 17:56:49 +00:00
|
|
|
double bearingDiff = r - _trueRadial;
|
|
|
|
SG_NORMALIZE_RANGE(bearingDiff, -180.0, 180.0);
|
|
|
|
if (fabs(bearingDiff) < 0.5) {
|
2009-10-11 12:37:13 +01:00
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double distanceToWayptM() const
|
|
|
|
{
|
|
|
|
return SGGeodesy::distanceM(_rnav->position(), position());
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual SGGeod position() const
|
|
|
|
{
|
2015-01-10 17:56:49 +00:00
|
|
|
return _projectedPosition;
|
2015-01-02 23:58:29 +00:00
|
|
|
}
|
2009-10-11 12:37:13 +01:00
|
|
|
private:
|
|
|
|
double _trueRadial;
|
2015-01-10 17:56:49 +00:00
|
|
|
SGGeod _projectedPosition;
|
2009-10-11 12:37:13 +01:00
|
|
|
};
|
|
|
|
|
|
|
|
class DMEInterceptCtl : public WayptController
|
|
|
|
{
|
|
|
|
public:
|
|
|
|
DMEInterceptCtl(RNAV* aRNAV, const WayptRef& aWpt) :
|
2010-12-05 20:35:21 +01:00
|
|
|
WayptController(aRNAV, aWpt),
|
|
|
|
_dme(NULL),
|
|
|
|
_distanceNm(0.0)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
if (_waypt->type() != "dmeIntercept") {
|
|
|
|
throw sg_exception("invalid waypoint type", "DMEInterceptCtl ctor");
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual void init()
|
|
|
|
{
|
|
|
|
_dme = (DMEIntercept*) _waypt.get();
|
|
|
|
_targetTrack = _dme->courseDegMagnetic() + _rnav->magvarDeg();
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual void update(double)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
_distanceNm = SGGeodesy::distanceNm(_rnav->position(), _dme->position());
|
|
|
|
double d = fabs(_distanceNm - _dme->dmeDistanceNm());
|
|
|
|
if (d < 0.1) {
|
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double distanceToWayptM() const
|
|
|
|
{
|
|
|
|
return fabs(_distanceNm - _dme->dmeDistanceNm()) * SG_NM_TO_METER;
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual SGGeod position() const
|
|
|
|
{
|
|
|
|
SGGeoc geocPos = SGGeoc::fromGeod(_rnav->position());
|
|
|
|
SGGeoc navid = SGGeoc::fromGeod(_dme->position());
|
|
|
|
double distRad = _dme->dmeDistanceNm() * SG_NM_TO_RAD;
|
|
|
|
|
|
|
|
// compute radial GC course
|
|
|
|
SGGeoc bPt;
|
|
|
|
SGGeodesy::advanceRadM(geocPos, _targetTrack, 100 * SG_NM_TO_RAD, bPt);
|
|
|
|
|
|
|
|
double dNm = pointsKnownDistanceFromGC(geocPos, bPt, navid, distRad);
|
|
|
|
if (dNm < 0.0) {
|
|
|
|
SG_LOG(SG_AUTOPILOT, SG_WARN, "DMEInterceptCtl::position failed");
|
|
|
|
return _dme->position(); // horrible fallback
|
|
|
|
}
|
|
|
|
|
|
|
|
return SGGeodesy::direct(_rnav->position(), _targetTrack, dNm * SG_NM_TO_METER);
|
|
|
|
}
|
2009-10-11 12:37:13 +01:00
|
|
|
|
|
|
|
private:
|
|
|
|
DMEIntercept* _dme;
|
|
|
|
double _distanceNm;
|
|
|
|
};
|
|
|
|
|
|
|
|
class HoldCtl : public WayptController
|
|
|
|
{
|
|
|
|
public:
|
|
|
|
HoldCtl(RNAV* aRNAV, const WayptRef& aWpt) :
|
|
|
|
WayptController(aRNAV, aWpt)
|
|
|
|
|
|
|
|
{
|
|
|
|
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual void init()
|
|
|
|
{
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual void update(double)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
// fly inbound / outbound sides, or execute the turn
|
|
|
|
#if 0
|
|
|
|
if (inTurn) {
|
|
|
|
|
|
|
|
targetTrack += dt * turnRateSec * turnDirection;
|
|
|
|
if (inbound) {
|
|
|
|
if .. targetTrack has passed inbound radial, doen with this turn
|
|
|
|
} else {
|
|
|
|
if target track has passed reciprocal radial done with turn
|
|
|
|
}
|
|
|
|
} else {
|
|
|
|
check time / distance elapsed
|
|
|
|
|
|
|
|
if (sideDone) {
|
|
|
|
inTurn = true;
|
|
|
|
inbound = !inbound;
|
|
|
|
nextHeading = inbound;
|
|
|
|
if (!inbound) {
|
|
|
|
nextHeading += 180.0;
|
|
|
|
SG_NORMALIZE_RANGE(nextHeading, 0.0, 360.0);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
}
|
|
|
|
|
|
|
|
#endif
|
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double distanceToWayptM() const
|
|
|
|
{
|
|
|
|
return -1.0;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual SGGeod position() const
|
|
|
|
{
|
|
|
|
return _waypt->position();
|
|
|
|
}
|
|
|
|
};
|
|
|
|
|
|
|
|
class VectorsCtl : public WayptController
|
|
|
|
{
|
|
|
|
public:
|
|
|
|
VectorsCtl(RNAV* aRNAV, const WayptRef& aWpt) :
|
|
|
|
WayptController(aRNAV, aWpt)
|
|
|
|
|
|
|
|
{
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual void init()
|
|
|
|
{
|
|
|
|
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
virtual void update(double)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
setDone();
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual double distanceToWayptM() const
|
|
|
|
{
|
|
|
|
return -1.0;
|
|
|
|
}
|
|
|
|
|
|
|
|
virtual SGGeod position() const
|
|
|
|
{
|
|
|
|
return _waypt->position();
|
|
|
|
}
|
|
|
|
|
|
|
|
private:
|
|
|
|
};
|
|
|
|
|
|
|
|
///////////////////////////////////////////////////////////////////////////////
|
|
|
|
|
|
|
|
DirectToController::DirectToController(RNAV* aRNAV, const WayptRef& aWpt, const SGGeod& aOrigin) :
|
|
|
|
WayptController(aRNAV, aWpt),
|
2010-12-05 20:35:21 +01:00
|
|
|
_origin(aOrigin),
|
2013-07-27 14:06:03 +02:00
|
|
|
_distanceAircraftTargetMeter(0.0),
|
|
|
|
_courseDev(0.0),
|
|
|
|
_courseAircraftToTarget(0.0)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
}
|
|
|
|
|
|
|
|
void DirectToController::init()
|
|
|
|
{
|
|
|
|
if (_waypt->flag(WPT_DYNAMIC)) {
|
|
|
|
throw sg_exception("can't direct-to a dynamic waypoint");
|
|
|
|
}
|
2013-07-27 14:06:03 +02:00
|
|
|
|
2009-10-11 12:37:13 +01:00
|
|
|
_targetTrack = SGGeodesy::courseDeg(_origin, _waypt->position());
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
void DirectToController::update(double)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
double courseOriginToAircraft;
|
|
|
|
|
|
|
|
courseOriginToAircraft = SGGeodesy::courseDeg(_origin,_rnav->position());
|
|
|
|
|
|
|
|
_courseAircraftToTarget = SGGeodesy::courseDeg(_rnav->position(),_waypt->position());
|
|
|
|
_distanceAircraftTargetMeter = SGGeodesy::distanceM(_rnav->position(),_waypt->position());
|
|
|
|
|
|
|
|
_courseDev = -(courseOriginToAircraft - _targetTrack);
|
|
|
|
|
2009-10-11 12:37:13 +01:00
|
|
|
SG_NORMALIZE_RANGE(_courseDev, -180.0, 180.0);
|
2013-07-27 14:06:03 +02:00
|
|
|
|
|
|
|
bool isMinimumOverFlightDistanceReached = _distanceAircraftTargetMeter < _rnav->overflightDistanceM();
|
|
|
|
bool isOverFlightConeArmed = _distanceAircraftTargetMeter < ( _rnav->overflightArmDistanceM() + _rnav->overflightDistanceM() );
|
|
|
|
bool leavingOverFlightCone = (fabs(_courseAircraftToTarget - _targetTrack) > _rnav->overflightArmAngleDeg());
|
|
|
|
|
|
|
|
if( isMinimumOverFlightDistanceReached ){
|
|
|
|
setDone();
|
|
|
|
}else{
|
|
|
|
if( isOverFlightConeArmed && leavingOverFlightCone ){
|
|
|
|
setDone();
|
|
|
|
}
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
double DirectToController::distanceToWayptM() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
return _distanceAircraftTargetMeter;
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
double DirectToController::xtrackErrorNm() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
return greatCircleCrossTrackError(_distanceAircraftTargetMeter * SG_METER_TO_NM, _courseDev);
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
double DirectToController::courseDeviationDeg() const
|
|
|
|
{
|
|
|
|
return _courseDev;
|
|
|
|
}
|
|
|
|
|
|
|
|
double DirectToController::trueBearingDeg() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
return _courseAircraftToTarget;
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
SGGeod DirectToController::position() const
|
|
|
|
{
|
|
|
|
return _waypt->position();
|
|
|
|
}
|
|
|
|
|
|
|
|
///////////////////////////////////////////////////////////////////////////////
|
|
|
|
|
|
|
|
OBSController::OBSController(RNAV* aRNAV, const WayptRef& aWpt) :
|
2010-12-05 20:35:21 +01:00
|
|
|
WayptController(aRNAV, aWpt),
|
2013-07-27 14:06:03 +02:00
|
|
|
_distanceAircraftTargetMeter(0.0),
|
|
|
|
_courseDev(0.0),
|
|
|
|
_courseAircraftToTarget(0.0)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
}
|
|
|
|
|
|
|
|
void OBSController::init()
|
|
|
|
{
|
|
|
|
if (_waypt->flag(WPT_DYNAMIC)) {
|
|
|
|
throw sg_exception("can't use a dynamic waypoint for OBS mode");
|
|
|
|
}
|
|
|
|
|
|
|
|
_targetTrack = _rnav->selectedMagCourse() + _rnav->magvarDeg();
|
|
|
|
}
|
|
|
|
|
2015-01-02 23:58:29 +00:00
|
|
|
void OBSController::update(double)
|
2009-10-11 12:37:13 +01:00
|
|
|
{
|
|
|
|
_targetTrack = _rnav->selectedMagCourse() + _rnav->magvarDeg();
|
2013-07-27 14:06:03 +02:00
|
|
|
|
|
|
|
_courseAircraftToTarget = SGGeodesy::courseDeg(_rnav->position(),_waypt->position());
|
|
|
|
_distanceAircraftTargetMeter = SGGeodesy::distanceM(_rnav->position(),_waypt->position());
|
|
|
|
|
|
|
|
// _courseDev inverted we use point target as origin
|
|
|
|
_courseDev = (_courseAircraftToTarget - _targetTrack);
|
2009-10-11 12:37:13 +01:00
|
|
|
SG_NORMALIZE_RANGE(_courseDev, -180.0, 180.0);
|
|
|
|
}
|
|
|
|
|
|
|
|
bool OBSController::toFlag() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
return (fabs(_courseDev) < _rnav->overflightArmAngleDeg());
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
double OBSController::distanceToWayptM() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
return _distanceAircraftTargetMeter;
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
double OBSController::xtrackErrorNm() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
return greatCircleCrossTrackError(_distanceAircraftTargetMeter * SG_METER_TO_NM, _courseDev);
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
double OBSController::courseDeviationDeg() const
|
|
|
|
{
|
|
|
|
// if (fabs(_courseDev) > 90.0) {
|
|
|
|
// double d = -_courseDev;
|
|
|
|
// SG_NORMALIZE_RANGE(d, -90.0, 90.0);
|
|
|
|
// return d;
|
|
|
|
//}
|
|
|
|
|
|
|
|
return _courseDev;
|
|
|
|
}
|
|
|
|
|
|
|
|
double OBSController::trueBearingDeg() const
|
|
|
|
{
|
2013-07-27 14:06:03 +02:00
|
|
|
return _courseAircraftToTarget;
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
SGGeod OBSController::position() const
|
|
|
|
{
|
|
|
|
return _waypt->position();
|
|
|
|
}
|
|
|
|
|
|
|
|
///////////////////////////////////////////////////////////////////////////////
|
|
|
|
|
|
|
|
WayptController* WayptController::createForWaypt(RNAV* aRNAV, const WayptRef& aWpt)
|
|
|
|
{
|
|
|
|
if (!aWpt) {
|
|
|
|
throw sg_exception("Passed null waypt", "WayptController::createForWaypt");
|
|
|
|
}
|
|
|
|
|
|
|
|
const std::string& wty(aWpt->type());
|
|
|
|
if (wty == "runway") {
|
|
|
|
return new RunwayCtl(aRNAV, aWpt);
|
|
|
|
}
|
|
|
|
|
|
|
|
if (wty == "radialIntercept") {
|
|
|
|
return new InterceptCtl(aRNAV, aWpt);
|
|
|
|
}
|
|
|
|
|
|
|
|
if (wty == "dmeIntercept") {
|
|
|
|
return new DMEInterceptCtl(aRNAV, aWpt);
|
|
|
|
}
|
|
|
|
|
|
|
|
if (wty == "hdgToAlt") {
|
|
|
|
return new ConstHdgToAltCtl(aRNAV, aWpt);
|
|
|
|
}
|
|
|
|
|
|
|
|
if (wty == "vectors") {
|
|
|
|
return new VectorsCtl(aRNAV, aWpt);
|
|
|
|
}
|
|
|
|
|
|
|
|
if (wty == "hold") {
|
|
|
|
return new HoldCtl(aRNAV, aWpt);
|
|
|
|
}
|
|
|
|
|
2013-07-27 14:06:03 +02:00
|
|
|
return new LegWayptCtl(aRNAV, aWpt);
|
2009-10-11 12:37:13 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
} // of namespace flightgear
|
|
|
|
|